* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL WUXINP01422 |
| English Synonyms: | WUXI-NATURAL WUXINP01422 |
| MDL Number.: | MFCD21333565 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1cc2c(cc1O)C3(CCCC(C3C=C2)(C)C)C=O |
| InChi: | InChI=1S/C18H22O2/c1-12-9-13-5-6-16-17(2,3)7-4-8-18(16,11-19)14(13)10-15(12)20/h5-6,9-11,16,20H,4,7-8H2,1-3H3 |
| InChiKey: | InChIKey=HFUVDFUUPWJIKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.