* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01423 |
English Synonyms: | WUXI-NATURAL WUXINP01423 |
MDL Number.: | MFCD21333566 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)C1=C(C(=O)c2c(ccc3c2CCCC3(C)C(=O)OC)C1=O)O |
InChi: | InChI=1S/C20H22O5/c1-10(2)14-16(21)12-7-8-13-11(15(12)18(23)17(14)22)6-5-9-20(13,3)19(24)25-4/h7-8,10,22H,5-6,9H2,1-4H3 |
InChiKey: | InChIKey=DTGOPEXASLQQJT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.