* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL WUXINP01425 |
| English Synonyms: | WUXI-NATURAL WUXINP01425 |
| MDL Number.: | MFCD21333568 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCOC1c2c(ccc3c2c(c(c(c3)C(C)C)O)OC1C=C(C)C)C |
| InChi: | InChI=1S/C22H28O3/c1-7-24-21-17(10-12(2)3)25-22-19-15(9-8-14(6)18(19)21)11-16(13(4)5)20(22)23/h8-11,13,17,21,23H,7H2,1-6H3 |
| InChiKey: | InChIKey=WONLCVUAXGCCRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.