* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01434 |
English Synonyms: | WUXI-NATURAL WUXINP01434 |
MDL Number.: | MFCD21333576 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC(C)c1cc2c(c(c1O)O)C3=CCCC(C3(C=C2)C)(C)C |
InChi: | InChI=1S/C20H26O2/c1-12(2)14-11-13-8-10-20(5)15(7-6-9-19(20,3)4)16(13)18(22)17(14)21/h7-8,10-12,21-22H,6,9H2,1-5H3 |
InChiKey: | InChIKey=RGZFDXJHQPJDER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.