* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL WUXINP01436 |
| English Synonyms: | WUXI-NATURAL WUXINP01436 |
| MDL Number.: | MFCD21333578 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)C1=CC2=CC(=O)C3(C(CCCC3(C2=C(C1=O)O)C)(C)C)O |
| InChi: | InChI=1S/C20H26O4/c1-11(2)13-9-12-10-14(21)20(24)18(3,4)7-6-8-19(20,5)15(12)17(23)16(13)22/h9-11,23-24H,6-8H2,1-5H3 |
| InChiKey: | InChIKey=AVOYXTMOWAJADG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.