* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01438 |
English Synonyms: | WUXI-NATURAL WUXINP01438 |
MDL Number.: | MFCD21333580 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)C1=Cc2ccc3c(c2CC(=C1OC)O)CCCC3(C)C |
InChi: | InChI=1S/C21H28O2/c1-13(2)16-11-14-8-9-18-15(7-6-10-21(18,3)4)17(14)12-19(22)20(16)23-5/h8-9,11,13,22H,6-7,10,12H2,1-5H3 |
InChiKey: | InChIKey=YZHTVPQPZKCOHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.