* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01447 |
English Synonyms: | WUXI-NATURAL WUXINP01447 |
MDL Number.: | MFCD21333588 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CO)C1=Cc2ccc3c(c2C(=O)C1=O)CCCC3(C)C |
InChi: | InChI=1S/C19H22O3/c1-11(10-20)14-9-12-6-7-15-13(5-4-8-19(15,2)3)16(12)18(22)17(14)21/h6-7,9,11,20H,4-5,8,10H2,1-3H3 |
InChiKey: | InChIKey=BYUVIYNVJOALKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.