* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01571 |
English Synonyms: | WUXI-NATURAL WUXINP01571 |
MDL Number.: | MFCD21333648 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | C[C@H](CCC(C(C)(CO)O)O)C1CC([C@@]2([C@@]1(CC=C3C2=CCC4[C@@]3(CCC(=O)C4(C)C)C)C)C)O |
InChi: | InChI=1S/C30H48O5/c1-18(8-11-24(33)29(6,35)17-31)21-16-25(34)30(7)20-9-10-22-26(2,3)23(32)13-14-27(22,4)19(20)12-15-28(21,30)5/h9,12,18,21-22,24-25,31,33-35H,8,10-11,13-17H2,1-7H3/t18-,21?,22?,24?,25?,27-,28-,29?,30-/m1/s1 |
InChiKey: | InChIKey=JXDKEGQYSCUVBO-QANJOYLASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.