* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01618 |
English Synonyms: | WUXI-NATURAL WUXINP01618 |
MDL Number.: | MFCD21333663 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(C)C1CCC(=C)C2C1C=C(CC2)C=O |
InChi: | InChI=1S/C15H22O/c1-10(2)13-6-4-11(3)14-7-5-12(9-16)8-15(13)14/h8-10,13-15H,3-7H2,1-2H3 |
InChiKey: | InChIKey=BUKZRIKRHNKXNN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.