* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01630 |
English Synonyms: | WUXI-NATURAL WUXINP01630 |
MDL Number.: | MFCD21333674 |
H bond acceptor: | 11 |
H bond donor: | 5 |
Smile: | COC(=O)[C@@H]1[C@H]([C@@H]([C@H](C(O1)Oc2cc(c3c(=O)cc(oc3c2O)c4ccccc4)O)O)O)O |
InChi: | InChI=1S/C22H20O11/c1-30-21(29)20-17(27)16(26)18(28)22(33-20)32-13-8-11(24)14-10(23)7-12(31-19(14)15(13)25)9-5-3-2-4-6-9/h2-8,16-18,20,22,24-28H,1H3/t16-,17-,18+,20-,22?/m0/s1 |
InChiKey: | InChIKey=UBHZPFZMFTVBHK-ICNUUSJMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.