* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01636 |
English Synonyms: | WUXI-NATURAL WUXINP01636 |
MDL Number.: | MFCD21333678 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCO[C@H]1[C@@H](C2C(CCCC2(C3=C1C=C(C(=O)C3=O)C(C)C)C)(C)C)O |
InChi: | InChI=1S/C22H32O4/c1-7-26-19-14-11-13(12(2)3)16(23)17(24)15(14)22(6)10-8-9-21(4,5)20(22)18(19)25/h11-12,18-20,25H,7-10H2,1-6H3/t18-,19+,20?,22?/m0/s1 |
InChiKey: | InChIKey=RHQPLNUVVOUGKR-QRMBVLBGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.