* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01647 |
English Synonyms: | WUXI-NATURAL WUXINP01647 |
MDL Number.: | MFCD21333688 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cccc2c1ccc-3c2[C@@](C(=O)c4c3occ4C)(CC(=O)C)O |
InChi: | InChI=1S/C21H18O4/c1-11-5-4-6-15-14(11)7-8-16-18(15)21(24,9-13(3)22)20(23)17-12(2)10-25-19(16)17/h4-8,10,24H,9H2,1-3H3/t21-/m1/s1 |
InChiKey: | InChIKey=WJDNZDJWZBAWCP-OAQYLSRUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.