* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01658 |
English Synonyms: | WUXI-NATURAL WUXINP01658 |
MDL Number.: | MFCD21333697 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC1=CCC2C(CCCC2(C1CC/C(=C/C=O)/C)C)(C)CO |
InChi: | InChI=1S/C20H32O2/c1-15(10-13-21)6-8-17-16(2)7-9-18-19(3,14-22)11-5-12-20(17,18)4/h7,10,13,17-18,22H,5-6,8-9,11-12,14H2,1-4H3/b15-10+ |
InChiKey: | InChIKey=UBUKQIZPHDXZMW-XNTDXEJSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.