* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01663 |
English Synonyms: | WUXI-NATURAL WUXINP01663 |
MDL Number.: | MFCD21333701 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1cc2c(c3c1-c4c(c(co4)CO)C(=O)C3=O)CCCC2(CO)O |
InChi: | InChI=1S/C18H16O6/c19-6-9-7-24-17-11-3-4-12-10(2-1-5-18(12,23)8-20)14(11)16(22)15(21)13(9)17/h3-4,7,19-20,23H,1-2,5-6,8H2 |
InChiKey: | InChIKey=YTHYRTDSBSMJLI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.