* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GANODERIC ACID C6 |
| English Synonyms: | GANODERIC ACID C6 |
| MDL Number.: | MFCD21333706 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | C[C@H](CC(=O)CC(C)C(=O)O)C1CC(=O)[C@@]2([C@@]1(C(C(=O)C3=C2C(=O)CC4[C@@]3(CCC(C4(C)C)O)C)O)C)C |
| InChi: | InChI=1S/C30H42O8/c1-14(10-16(31)11-15(2)26(37)38)17-12-21(34)30(7)22-18(32)13-19-27(3,4)20(33)8-9-28(19,5)23(22)24(35)25(36)29(17,30)6/h14-15,17,19-20,25,33,36H,8-13H2,1-7H3,(H,37,38)/t14-,15?,17?,19?,20?,25?,28+,29+,30+/m1/s1 |
| InChiKey: | InChIKey=BTYTWXWAFWKSTA-BPLYHITDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.