* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01739 |
English Synonyms: | WUXI-NATURAL WUXINP01739 |
MDL Number.: | MFCD21333744 |
H bond acceptor: | 7 |
H bond donor: | 5 |
Smile: | CC(=CCc1c(=O)c2c(cc(cc2oc1c3ccc(c(c3O)C/C=C(/C)\CCCC(C)(C)O)O)O)O)C |
InChi: | InChI=1S/C30H36O7/c1-17(2)8-10-22-28(35)26-24(33)15-19(31)16-25(26)37-29(22)21-12-13-23(32)20(27(21)34)11-9-18(3)7-6-14-30(4,5)36/h8-9,12-13,15-16,31-34,36H,6-7,10-11,14H2,1-5H3/b18-9- |
InChiKey: | InChIKey=BQFVJXIHXZCKGQ-NVMNQCDNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.