* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01741 |
English Synonyms: | WUXI-NATURAL WUXINP01741 |
MDL Number.: | MFCD21333745 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | c1c(cc2c(c1O)C(=O)CC(O2)c3cc(c(cc3O)O)C=O)O |
InChi: | InChI=1S/C16H12O7/c17-6-7-1-9(11(20)4-10(7)19)14-5-13(22)16-12(21)2-8(18)3-15(16)23-14/h1-4,6,14,18-21H,5H2 |
InChiKey: | InChIKey=PSRXNRBRHROXFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.