* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01744 |
English Synonyms: | WUXI-NATURAL WUXINP01744 |
MDL Number.: | MFCD21333746 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | COc1cc(c2cc(oc2c1)c3cc(cc(c3)O)O)O |
InChi: | InChI=1S/C15H12O5/c1-19-11-5-13(18)12-7-14(20-15(12)6-11)8-2-9(16)4-10(17)3-8/h2-7,16-18H,1H3 |
InChiKey: | InChIKey=OERNARMUEYFFPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.