* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01748 |
English Synonyms: | WUXI-NATURAL WUXINP01748 |
MDL Number.: | MFCD21333749 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1cc2c(cc1O)C3(CCCC(C3CC2=O)(C)C)CO |
InChi: | InChI=1S/C18H24O3/c1-11-7-12-13(8-14(11)20)18(10-19)6-4-5-17(2,3)16(18)9-15(12)21/h7-8,16,19-20H,4-6,9-10H2,1-3H3 |
InChiKey: | InChIKey=WYFZAQAZOUEOAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.