* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01749 |
English Synonyms: | WUXI-NATURAL WUXINP01749 |
MDL Number.: | MFCD21333750 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOC(=O)c1c(ccc2c1CCCC2(C)C)c3c(c(co3)CO)C(=O)O |
InChi: | InChI=1S/C21H24O6/c1-4-26-20(25)17-13-6-5-9-21(2,3)15(13)8-7-14(17)18-16(19(23)24)12(10-22)11-27-18/h7-8,11,22H,4-6,9-10H2,1-3H3,(H,23,24) |
InChiKey: | InChIKey=IFHREPASTAVTHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.