* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUSHENOL M |
| English Synonyms: | KUSHENOL M |
| MDL Number.: | MFCD21333763 |
| H bond acceptor: | 7 |
| H bond donor: | 5 |
| Smile: | CC(=CCc1c(c(c2c(c1O)C(=O)C([C@H](O2)c3ccc(cc3O)O)O)C[C@@H](CC=C(C)C)C(=C)C)O)C |
| InChi: | InChI=1S/C30H36O7/c1-15(2)7-9-18(17(5)6)13-22-25(33)21(11-8-16(3)4)26(34)24-27(35)28(36)30(37-29(22)24)20-12-10-19(31)14-23(20)32/h7-8,10,12,14,18,28,30-34,36H,5,9,11,13H2,1-4,6H3/t18-,28?,30-/m1/s1 |
| InChiKey: | InChIKey=AMIPWEKLJVRITL-CJQWMBQHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.