* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 101_Y01A004 |
| English Synonyms: | WUXI-NATURAL 101_Y01A004 |
| MDL Number.: | MFCD21333779 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)NCCN6CCCCC6)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C39H62N2O4/c1-34(2)16-18-39(33(44)45-8)19-17-37(6)27(28(39)25-34)12-13-30-36(5)24-26(32(43)40-20-23-41-21-10-9-11-22-41)31(42)35(3,4)29(36)14-15-38(30,37)7/h12,26,28-30H,9-11,13-25H2,1-8H3,(H,40,43)/t26?,28?,29?,30?,36-,37+,38+,39-/m0/s1 |
| InChiKey: | InChIKey=BLHMDXBXOXXQLP-BFUBAGJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.