* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 101_Y01A006 |
| English Synonyms: | WUXI-NATURAL 101_Y01A006 |
| MDL Number.: | MFCD21333781 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(c1)CNC(=O)C2C[C@]3(C(CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C(C2=O)(C)C)C |
| InChi: | InChI=1S/C40H57NO4/c1-25-11-10-12-26(21-25)24-41-33(43)27-22-37(6)30(36(4,5)32(27)42)15-16-39(8)31(37)14-13-28-29-23-35(2,3)17-19-40(29,34(44)45-9)20-18-38(28,39)7/h10-13,21,27,29-31H,14-20,22-24H2,1-9H3,(H,41,43)/t27?,29?,30?,31?,37-,38+,39+,40-/m0/s1 |
| InChiKey: | InChIKey=NDLWVXXECGNLHT-GSTSGHFISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.