* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A009 |
English Synonyms: | WUXI-NATURAL 101_Y01A009 |
MDL Number.: | MFCD21333784 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)NCCCc6ccccc6)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C41H59NO4/c1-36(2)20-22-41(35(45)46-8)23-21-39(6)29(30(41)26-36)16-17-32-38(5)25-28(33(43)37(3,4)31(38)18-19-40(32,39)7)34(44)42-24-12-15-27-13-10-9-11-14-27/h9-11,13-14,16,28,30-32H,12,15,17-26H2,1-8H3,(H,42,44)/t28?,30?,31?,32?,38-,39+,40+,41-/m0/s1 |
InChiKey: | InChIKey=ALEIVPYIHVOUQU-GZNDAEJESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.