* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 101_Y01A010 |
| English Synonyms: | WUXI-NATURAL 101_Y01A010 |
| MDL Number.: | MFCD21333785 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCN(CC)CCN(C)C(=O)C1C[C@]2(C(CC[C@@]3(C2CC=C4[C@]3(CC[C@@]5(C4CC(CC5)(C)C)C(=O)OC)C)C)C(C1=O)(C)C)C |
| InChi: | InChI=1S/C39H64N2O4/c1-12-41(13-2)23-22-40(10)32(43)26-24-36(7)29(35(5,6)31(26)42)16-17-38(9)30(36)15-14-27-28-25-34(3,4)18-20-39(28,33(44)45-11)21-19-37(27,38)8/h14,26,28-30H,12-13,15-25H2,1-11H3/t26?,28?,29?,30?,36-,37+,38+,39-/m0/s1 |
| InChiKey: | InChIKey=VFVMTTZJNKORKN-BFUBAGJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.