* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A011 |
English Synonyms: | WUXI-NATURAL 101_Y01A011 |
MDL Number.: | MFCD21333786 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)CNC(=O)C1C[C@]2(C(CC[C@@]3(C2CC=C4[C@]3(CC[C@@]5(C4CC(CC5)(C)C)C(=O)OC)C)C)C(C1=O)(C)C)C |
InChi: | InChI=1S/C36H57NO4/c1-22(2)21-37-29(39)23-19-33(7)26(32(5,6)28(23)38)13-14-35(9)27(33)12-11-24-25-20-31(3,4)15-17-36(25,30(40)41-10)18-16-34(24,35)8/h11,22-23,25-27H,12-21H2,1-10H3,(H,37,39)/t23?,25?,26?,27?,33-,34+,35+,36-/m0/s1 |
InChiKey: | InChIKey=DIPFFVXASKRNIX-WIANCKDBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.