* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A012 |
English Synonyms: | WUXI-NATURAL 101_Y01A012 |
MDL Number.: | MFCD21333787 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCN(CC)CCNC(=O)C1C[C@]2(C(CC[C@@]3(C2CC=C4[C@]3(CC[C@@]5(C4CC(CC5)(C)C)C(=O)OC)C)C)C(C1=O)(C)C)C |
InChi: | InChI=1S/C38H62N2O4/c1-11-40(12-2)22-21-39-31(42)25-23-35(7)28(34(5,6)30(25)41)15-16-37(9)29(35)14-13-26-27-24-33(3,4)17-19-38(27,32(43)44-10)20-18-36(26,37)8/h13,25,27-29H,11-12,14-24H2,1-10H3,(H,39,42)/t25?,27?,28?,29?,35-,36+,37+,38-/m0/s1 |
InChiKey: | InChIKey=PZLGNUVNLNWCHQ-PZPPWAJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.