* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A015 |
English Synonyms: | WUXI-NATURAL 101_Y01A015 |
MDL Number.: | MFCD21333790 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1ccccc1CNC(=O)C2C[C@]3(C(CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C(C2=O)(C)C)C |
InChi: | InChI=1S/C40H57NO4/c1-25-12-10-11-13-26(25)24-41-33(43)27-22-37(6)30(36(4,5)32(27)42)16-17-39(8)31(37)15-14-28-29-23-35(2,3)18-20-40(29,34(44)45-9)21-19-38(28,39)7/h10-14,27,29-31H,15-24H2,1-9H3,(H,41,43)/t27?,29?,30?,31?,37-,38+,39+,40-/m0/s1 |
InChiKey: | InChIKey=ULNFPXUNARWGAQ-GSTSGHFISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.