* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A023 |
English Synonyms: | WUXI-NATURAL 101_Y01A023 |
MDL Number.: | MFCD21333798 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)NCCc6ccncc6)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H56N2O4/c1-34(2)16-18-39(33(44)45-8)19-17-37(6)27(28(39)24-34)9-10-30-36(5)23-26(32(43)41-22-14-25-12-20-40-21-13-25)31(42)35(3,4)29(36)11-15-38(30,37)7/h9,12-13,20-21,26,28-30H,10-11,14-19,22-24H2,1-8H3,(H,41,43)/t26?,28?,29?,30?,36-,37+,38+,39-/m0/s1 |
InChiKey: | InChIKey=NQNOTXAUOJVYIQ-BFUBAGJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.