* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A025 |
English Synonyms: | WUXI-NATURAL 101_Y01A025 |
MDL Number.: | MFCD21333800 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)N6CCN(CC6)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C37H58N2O4/c1-32(2)14-16-37(31(42)43-9)17-15-35(6)25(26(37)23-32)10-11-28-34(5)22-24(30(41)39-20-18-38(8)19-21-39)29(40)33(3,4)27(34)12-13-36(28,35)7/h10,24,26-28H,11-23H2,1-9H3/t24?,26?,27?,28?,34-,35+,36+,37-/m0/s1 |
InChiKey: | InChIKey=QXHIFYUMRXEDOU-CXTUKRMXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.