* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A030 |
English Synonyms: | WUXI-NATURAL 101_Y01A030 |
MDL Number.: | MFCD21333805 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)NCc6ccc(cc6)C(F)(F)F)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C40H54F3NO4/c1-34(2)17-19-39(33(47)48-8)20-18-37(6)27(28(39)22-34)13-14-30-36(5)21-26(31(45)35(3,4)29(36)15-16-38(30,37)7)32(46)44-23-24-9-11-25(12-10-24)40(41,42)43/h9-13,26,28-30H,14-23H2,1-8H3,(H,44,46)/t26?,28?,29?,30?,36-,37+,38+,39-/m0/s1 |
InChiKey: | InChIKey=MSLCZSKWOOQVJR-BFUBAGJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.