* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A036 |
English Synonyms: | WUXI-NATURAL 101_Y01A036 |
MDL Number.: | MFCD21333811 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)NCCc6ccccc6)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C40H57NO4/c1-35(2)19-21-40(34(44)45-8)22-20-38(6)28(29(40)25-35)14-15-31-37(5)24-27(33(43)41-23-17-26-12-10-9-11-13-26)32(42)36(3,4)30(37)16-18-39(31,38)7/h9-14,27,29-31H,15-25H2,1-8H3,(H,41,43)/t27?,29?,30?,31?,37-,38+,39+,40-/m0/s1 |
InChiKey: | InChIKey=DFNGWNABCYSHBG-GSTSGHFISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.