* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 101_Y01A042 |
| English Synonyms: | WUXI-NATURAL 101_Y01A042 |
| MDL Number.: | MFCD21333817 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)NCCCN(C)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C37H60N2O4/c1-32(2)16-18-37(31(42)43-10)19-17-35(6)25(26(37)23-32)12-13-28-34(5)22-24(30(41)38-20-11-21-39(8)9)29(40)33(3,4)27(34)14-15-36(28,35)7/h12,24,26-28H,11,13-23H2,1-10H3,(H,38,41)/t24?,26?,27?,28?,34-,35+,36+,37-/m0/s1 |
| InChiKey: | InChIKey=JBEPQXLLPCVGLB-CXTUKRMXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.