* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A045 |
English Synonyms: | WUXI-NATURAL 101_Y01A045 |
MDL Number.: | MFCD21333820 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCCCN(CC)C(=O)C1C[C@]2(C(CC[C@@]3(C2CC=C4[C@]3(CC[C@@]5(C4CC(CC5)(C)C)C(=O)OC)C)C)C(C1=O)(C)C)C |
InChi: | InChI=1S/C38H61NO4/c1-11-13-22-39(12-2)31(41)25-23-35(7)28(34(5,6)30(25)40)16-17-37(9)29(35)15-14-26-27-24-33(3,4)18-20-38(27,32(42)43-10)21-19-36(26,37)8/h14,25,27-29H,11-13,15-24H2,1-10H3/t25?,27?,28?,29?,35-,36+,37+,38-/m0/s1 |
InChiKey: | InChIKey=WXNZDADNWZLYRI-PZPPWAJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.