* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A049 |
English Synonyms: | WUXI-NATURAL 101_Y01A049 |
MDL Number.: | MFCD21333824 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCN(CCNC(=O)C1C[C@]2(C(CC[C@@]3(C2CC=C4[C@]3(CC[C@@]5(C4CC(CC5)(C)C)C(=O)OC)C)C)C(C1=O)(C)C)C)c6cccc(c6)C |
InChi: | InChI=1S/C43H64N2O4/c1-11-45(29-14-12-13-28(2)25-29)24-23-44-36(47)30-26-40(7)33(39(5,6)35(30)46)17-18-42(9)34(40)16-15-31-32-27-38(3,4)19-21-43(32,37(48)49-10)22-20-41(31,42)8/h12-15,25,30,32-34H,11,16-24,26-27H2,1-10H3,(H,44,47)/t30?,32?,33?,34?,40-,41+,42+,43-/m0/s1 |
InChiKey: | InChIKey=REIRKTLYSAEDPK-ZFXXZVRGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.