* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A058 |
English Synonyms: | WUXI-NATURAL 101_Y01A058 |
MDL Number.: | MFCD21333833 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C)OCCNC(=O)C1C[C@]2(C(CC[C@@]3(C2CC=C4[C@]3(CC[C@@]5(C4CC(CC5)(C)C)C(=O)OC)C)C)C(C1=O)(C)C)C |
InChi: | InChI=1S/C37H59NO5/c1-23(2)43-20-19-38-30(40)24-21-34(7)27(33(5,6)29(24)39)13-14-36(9)28(34)12-11-25-26-22-32(3,4)15-17-37(26,31(41)42-10)18-16-35(25,36)8/h11,23-24,26-28H,12-22H2,1-10H3,(H,38,40)/t24?,26?,27?,28?,34-,35+,36+,37-/m0/s1 |
InChiKey: | InChIKey=UYOUKTGCFITNED-CXTUKRMXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.