* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A059 |
English Synonyms: | WUXI-NATURAL 101_Y01A059 |
MDL Number.: | MFCD21333834 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)NCCN6CCOCC6)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C38H60N2O5/c1-33(2)13-15-38(32(43)44-8)16-14-36(6)26(27(38)24-33)9-10-29-35(5)23-25(31(42)39-17-18-40-19-21-45-22-20-40)30(41)34(3,4)28(35)11-12-37(29,36)7/h9,25,27-29H,10-24H2,1-8H3,(H,39,42)/t25?,27?,28?,29?,35-,36+,37+,38-/m0/s1 |
InChiKey: | InChIKey=CNDLQCKBEHDZTI-PZPPWAJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.