* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A064 |
English Synonyms: | WUXI-NATURAL 101_Y01A064 |
MDL Number.: | MFCD21333839 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)NC(=O)C1C[C@]2(C(CC[C@@]3(C2CC=C4[C@]3(CC[C@@]5(C4CC(CC5)(C)C)C(=O)OC)C)C)C(C1=O)(C)C)C |
InChi: | InChI=1S/C35H55NO4/c1-21(2)36-28(38)22-19-32(7)25(31(5,6)27(22)37)13-14-34(9)26(32)12-11-23-24-20-30(3,4)15-17-35(24,29(39)40-10)18-16-33(23,34)8/h11,21-22,24-26H,12-20H2,1-10H3,(H,36,38)/t22?,24?,25?,26?,32-,33+,34+,35-/m0/s1 |
InChiKey: | InChIKey=AJANPJFKYOPIOE-JZDANDSUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.