* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A071 |
English Synonyms: | WUXI-NATURAL 101_Y01A071 |
MDL Number.: | MFCD21333846 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1CCC(CC1)NC(=O)C2C[C@]3(C(CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C(C2=O)(C)C)C |
InChi: | InChI=1S/C39H61NO4/c1-24-10-12-25(13-11-24)40-32(42)26-22-36(6)29(35(4,5)31(26)41)16-17-38(8)30(36)15-14-27-28-23-34(2,3)18-20-39(28,33(43)44-9)21-19-37(27,38)7/h14,24-26,28-30H,10-13,15-23H2,1-9H3,(H,40,42)/t24?,25?,26?,28?,29?,30?,36-,37+,38+,39-/m0/s1 |
InChiKey: | InChIKey=KEUYOFKSDPFNFM-OFGZWEIISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.