* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 101_Y01A079 |
| English Synonyms: | WUXI-NATURAL 101_Y01A079 |
| MDL Number.: | MFCD21333854 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC(C)N1CCN(CC1)C(=O)C2C[C@]3(C(CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C(C2=O)(C)C)C |
| InChi: | InChI=1S/C39H62N2O4/c1-25(2)40-19-21-41(22-20-40)32(43)26-23-36(7)29(35(5,6)31(26)42)13-14-38(9)30(36)12-11-27-28-24-34(3,4)15-17-39(28,33(44)45-10)18-16-37(27,38)8/h11,25-26,28-30H,12-24H2,1-10H3/t26?,28?,29?,30?,36-,37+,38+,39-/m0/s1 |
| InChiKey: | InChIKey=WEQUROKHPKWFEJ-BFUBAGJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.