* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 101_Y01A089 |
English Synonyms: | WUXI-NATURAL 101_Y01A089 |
MDL Number.: | MFCD21333864 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCCN(CC1CC1)C(=O)C2C[C@]3(C(CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C(C2=O)(C)C)C |
InChi: | InChI=1S/C39H61NO4/c1-10-21-40(24-25-11-12-25)32(42)26-22-36(6)29(35(4,5)31(26)41)15-16-38(8)30(36)14-13-27-28-23-34(2,3)17-19-39(28,33(43)44-9)20-18-37(27,38)7/h13,25-26,28-30H,10-12,14-24H2,1-9H3/t26?,28?,29?,30?,36-,37+,38+,39-/m0/s1 |
InChiKey: | InChIKey=NJCJVMUAVXUFOG-BFUBAGJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.