* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 101_Y01A092 |
| English Synonyms: | WUXI-NATURAL 101_Y01A092 |
| MDL Number.: | MFCD21333867 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC(C(=O)C5(C)C)C(=O)N(C)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C34H53NO4/c1-29(2)15-17-34(28(38)39-10)18-16-32(6)22(23(34)20-29)11-12-25-31(5)19-21(27(37)35(8)9)26(36)30(3,4)24(31)13-14-33(25,32)7/h11,21,23-25H,12-20H2,1-10H3/t21?,23?,24?,25?,31-,32+,33+,34-/m0/s1 |
| InChiKey: | InChIKey=BFVMWXIADQNKHX-SZBRLNJJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.