* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A001 |
English Synonyms: | WUXI-NATURAL 102_Y01A001 |
MDL Number.: | MFCD21333872 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc[nH]6)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C32H48N2O2/c1-27(2)13-15-32(26(35)36-8)16-14-30(6)20(21(32)17-27)9-10-24-29(5)18-22-25(34-19-33-22)28(3,4)23(29)11-12-31(24,30)7/h9,19,21,23-24H,10-18H2,1-8H3,(H,33,34)/t21?,23?,24?,29-,30+,31+,32-/m0/s1 |
InChiKey: | InChIKey=FECNGVBBFWHKDZ-WAGNLPIISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.