* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A002 |
English Synonyms: | WUXI-NATURAL 102_Y01A002 |
MDL Number.: | MFCD21333873 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1[nH]c2c(n1)C(C3CC[C@@]4(C([C@]3(C2)C)CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)(C)C |
InChi: | InChI=1S/C33H50N2O2/c1-20-34-23-19-30(6)24(29(4,5)26(23)35-20)12-13-32(8)25(30)11-10-21-22-18-28(2,3)14-16-33(22,27(36)37-9)17-15-31(21,32)7/h10,22,24-25H,11-19H2,1-9H3,(H,34,35)/t22?,24?,25?,30-,31+,32+,33-/m0/s1 |
InChiKey: | InChIKey=DEKGHJBKFRQFNY-GUCQSVKPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.