* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A007 |
English Synonyms: | WUXI-NATURAL 102_Y01A007 |
MDL Number.: | MFCD21333878 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)C(C)(C)C)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C36H56N2O2/c1-30(2,3)28-37-24-21-33(8)25(32(6,7)27(24)38-28)14-15-35(10)26(33)13-12-22-23-20-31(4,5)16-18-36(23,29(39)40-11)19-17-34(22,35)9/h12,23,25-26H,13-21H2,1-11H3,(H,37,38)/t23?,25?,26?,33-,34+,35+,36-/m0/s1 |
InChiKey: | InChIKey=OGRZJURMYAWNFX-GDQIYLSZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.