* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A016 |
English Synonyms: | WUXI-NATURAL 102_Y01A016 |
MDL Number.: | MFCD21333887 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)c1[nH]c2c(n1)C(C3CC[C@@]4(C([C@]3(C2)C)CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)(C)C |
InChi: | InChI=1S/C35H54N2O2/c1-21(2)28-36-24-20-32(7)25(31(5,6)27(24)37-28)13-14-34(9)26(32)12-11-22-23-19-30(3,4)15-17-35(23,29(38)39-10)18-16-33(22,34)8/h11,21,23,25-26H,12-20H2,1-10H3,(H,36,37)/t23?,25?,26?,32-,33+,34+,35-/m0/s1 |
InChiKey: | InChIKey=IMWDVHPHGPPBDQ-QMMVQTINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.