* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A019 |
English Synonyms: | WUXI-NATURAL 102_Y01A019 |
MDL Number.: | MFCD21333890 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)Cc7ccc(cc7)OC)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C40H56N2O3/c1-35(2)18-20-40(34(43)45-9)21-19-38(6)27(28(40)23-35)14-15-31-37(5)24-29-33(36(3,4)30(37)16-17-39(31,38)7)42-32(41-29)22-25-10-12-26(44-8)13-11-25/h10-14,28,30-31H,15-24H2,1-9H3,(H,41,42)/t28?,30?,31?,37-,38+,39+,40-/m0/s1 |
InChiKey: | InChIKey=YCTSCFONDUWIJK-YFURRWFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.