* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A021 |
English Synonyms: | WUXI-NATURAL 102_Y01A021 |
MDL Number.: | MFCD21333892 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)CC(=O)OC)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C35H52N2O4/c1-30(2)14-16-35(29(39)41-9)17-15-33(6)21(22(35)19-30)10-11-25-32(5)20-23-28(37-26(36-23)18-27(38)40-8)31(3,4)24(32)12-13-34(25,33)7/h10,22,24-25H,11-20H2,1-9H3,(H,36,37)/t22?,24?,25?,32-,33+,34+,35-/m0/s1 |
InChiKey: | InChIKey=JOCGDZKYKZLDIG-RUOAJDRTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.