* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A023 |
English Synonyms: | WUXI-NATURAL 102_Y01A023 |
MDL Number.: | MFCD21333894 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCCCCc1[nH]c2c(n1)C(C3CC[C@@]4(C([C@]3(C2)C)CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)(C)C |
InChi: | InChI=1S/C38H60N2O2/c1-10-11-12-13-14-30-39-27-24-35(6)28(34(4,5)31(27)40-30)17-18-37(8)29(35)16-15-25-26-23-33(2,3)19-21-38(26,32(41)42-9)22-20-36(25,37)7/h15,26,28-29H,10-14,16-24H2,1-9H3,(H,39,40)/t26?,28?,29?,35-,36+,37+,38-/m0/s1 |
InChiKey: | InChIKey=BZKQVPSOCRNBNF-DFCOLEDSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.