* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 102_Y01A031 |
| English Synonyms: | WUXI-NATURAL 102_Y01A031 |
| MDL Number.: | MFCD21333902 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)c7cccc(c7)Cl)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C38H51ClN2O2/c1-33(2)16-18-38(32(42)43-8)19-17-36(6)25(26(38)21-33)12-13-29-35(5)22-27-30(34(3,4)28(35)14-15-37(29,36)7)41-31(40-27)23-10-9-11-24(39)20-23/h9-12,20,26,28-29H,13-19,21-22H2,1-8H3,(H,40,41)/t26?,28?,29?,35-,36+,37+,38-/m0/s1 |
| InChiKey: | InChIKey=DJVOSDNETUMNNB-DFCOLEDSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.